C32H43N3O — CID 58549532
[(2S,4R)-2-cyclohexyl-4-(2-methylphenyl)piperidin-1-yl]-[(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 58549532) has the molecular formula C32H43N3O and a molecular weight of 485.72 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-(2-methylphenyl)piperidin-1-yl]-[(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-(2-methylphenyl)piperidin-1-yl]-[(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549532 |
| Molecular Formula | C32H43N3O |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-(2-methylphenyl)piperidin-1-yl]-[(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | Cc1ccc2c(n1)CCC[C@]21CNC[C@H]1C(=O)N1CC[C@@H](c2ccccc2C)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C32H43N3O/c1-22-9-6-7-12-26(22)25-16-18-35(30(19-25)24-10-4-3-5-11-24)31(36)28-20-33-21-32(28)17-8-13-29-27(32)15-14-23(2)34-29/h6-7,9,12,14-15,24-25,28,30,33H,3-5,8,10-11,13,16-21H2,1-2H3/t25-,28+,30+,32+/m1/s1 |
| InChIKey | JBZGKPZQQZQXJI-CZRDNUISSA-N |
| XLogP | 5.85 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |