C30H39Cl3FN3O — CID 161146348
[(3'S,5R)-2-chlorospiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-2-cyclohexyl-4-(2-fluorophenyl)piperidin-1-yl]methanone dichloride (PubChem CID 161146348) has the molecular formula C30H39Cl3FN3O and a molecular weight of 583.02 g/mol. Its IUPAC name is [(3'S,5R)-2-chlorospiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-2-cyclohexyl-4-(2-fluorophenyl)piperidin-1-yl]methanone dichloride.
| Compound Name | [(3'S,5R)-2-chlorospiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-2-cyclohexyl-4-(2-fluorophenyl)piperidin-1-yl]methanone dichloride |
|---|---|
| PubChem CID | 161146348 |
| Molecular Formula | C30H39Cl3FN3O |
| Molecular Weight | 583.02 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | [(3'S,5R)-2-chlorospiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-2-cyclohexyl-4-(2-fluorophenyl)piperidin-1-yl]methanone dichloride |
| SMILES | O=C([C@@H]1C[NH2+]C[C@]12CCCc1[nH+]c(Cl)ccc12)N1CC[C@@H](c2ccccc2F)C[C@H]1C1CCCCC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C30H37ClFN3O.2ClH/c31-28-13-12-23-26(34-28)11-6-15-30(23)19-33-18-24(30)29(36)35-16-14-21(22-9-4-5-10-25(22)32)17-27(35)20-7-2-1-3-8-20;;/h4-5,9-10,12-13,20-21,24,27,33H,1-3,6-8,11,14-19H2;2*1H/t21-,24+,27+,30+;;/m1../s1 |
| InChIKey | NAYQBQZRXABTNY-KVQFEJDNSA-N |
| XLogP | -1.58 |
| TPSA | 51.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.02 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|