C27H34Cl2F3N3O — CID 158644535
[(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone dichloride (PubChem CID 158644535) has the molecular formula C27H34Cl2F3N3O and a molecular weight of 544.49 g/mol. Its IUPAC name is [(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone dichloride.
| Compound Name | [(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone dichloride |
|---|---|
| PubChem CID | 158644535 |
| Molecular Formula | C27H34Cl2F3N3O |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | [(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone dichloride |
| SMILES | Cc1ccc2c([nH+]1)CCC[C@]21C[NH2+]C[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1CC(F)(F)F.[Cl-].[Cl-] |
| InChI | InChI=1S/C27H32F3N3O.2ClH/c1-18-9-10-22-24(32-18)8-5-12-26(22)17-31-16-23(26)25(34)33-13-11-20(19-6-3-2-4-7-19)14-21(33)15-27(28,29)30;;/h2-4,6-7,9-10,20-21,23,31H,5,8,11-17H2,1H3;2*1H/t20-,21+,23+,26+;;/m1../s1 |
| InChIKey | VMFFEQLSQJALHL-HILSUTFGSA-N |
| XLogP | -2.69 |
| TPSA | 51.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |