C26H31F3N4O — CID 46891931
[(3'S,5S)-2-methylspiro[7,8-dihydro-6H-1,7-naphthyridine-5,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone (PubChem CID 46891931) has the molecular formula C26H31F3N4O and a molecular weight of 472.56 g/mol. Its IUPAC name is [(3'S,5S)-2-methylspiro[7,8-dihydro-6H-1,7-naphthyridine-5,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone.
| Compound Name | [(3'S,5S)-2-methylspiro[7,8-dihydro-6H-1,7-naphthyridine-5,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46891931 |
| Molecular Formula | C26H31F3N4O |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | [(3'S,5S)-2-methylspiro[7,8-dihydro-6H-1,7-naphthyridine-5,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc2c(n1)CNC[C@]21CNC[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1CC(F)(F)F |
| InChI | InChI=1S/C26H31F3N4O/c1-17-7-8-21-23(32-17)14-31-16-25(21)15-30-13-22(25)24(34)33-10-9-19(18-5-3-2-4-6-18)11-20(33)12-26(27,28)29/h2-8,19-20,22,30-31H,9-16H2,1H3/t19-,20+,22+,25-/m1/s1 |
| InChIKey | SYVXMMWLBSOQBX-QIRSKFFZSA-N |
| XLogP | 3.68 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |