C24H29F3N4OS — CID 75229564
(2-methylspiro[5,6-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-7,4'-pyrrolidine]-3'-yl)-[4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone (PubChem CID 75229564) has the molecular formula C24H29F3N4OS and a molecular weight of 478.58 g/mol. Its IUPAC name is (2-methylspiro[5,6-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-7,4'-pyrrolidine]-3'-yl)-[4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone.
| Compound Name | (2-methylspiro[5,6-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-7,4'-pyrrolidine]-3'-yl)-[4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 75229564 |
| Molecular Formula | C24H29F3N4OS |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (2-methylspiro[5,6-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-7,4'-pyrrolidine]-3'-yl)-[4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
| SMILES | Cc1nc2c(s1)C1(CNC2)CNCC1C(=O)N1CCC(c2ccccc2)CC1CC(F)(F)F |
| InChI | InChI=1S/C24H29F3N4OS/c1-15-30-20-12-29-14-23(21(20)33-15)13-28-11-19(23)22(32)31-8-7-17(16-5-3-2-4-6-16)9-18(31)10-24(25,26)27/h2-6,17-19,28-29H,7-14H2,1H3 |
| InChIKey | WLVMMQFIAJBHEM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |