C27H30Cl2F3N3O3-2 — CID 46892064
[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]-[(3'S,6S)-spiro[8,9-dihydro-7H-[1,3]dioxolo[4,5-h]isoquinoline-6,4'-pyrrolidine]-3'-yl]methanone dichloride (PubChem CID 46892064) has the molecular formula C27H30Cl2F3N3O3-2 and a molecular weight of 572.46 g/mol. Its IUPAC name is [(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]-[(3'S,6S)-spiro[8,9-dihydro-7H-[1,3]dioxolo[4,5-h]isoquinoline-6,4'-pyrrolidine]-3'-yl]methanone dichloride.
| Compound Name | [(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]-[(3'S,6S)-spiro[8,9-dihydro-7H-[1,3]dioxolo[4,5-h]isoquinoline-6,4'-pyrrolidine]-3'-yl]methanone dichloride |
|---|---|
| PubChem CID | 46892064 |
| Molecular Formula | C27H30Cl2F3N3O3-2 |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | [(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]-[(3'S,6S)-spiro[8,9-dihydro-7H-[1,3]dioxolo[4,5-h]isoquinoline-6,4'-pyrrolidine]-3'-yl]methanone dichloride |
| SMILES | O=C([C@@H]1CNC[C@]12CNCc1c2ccc2c1OCO2)N1CC[C@@H](c2ccccc2)C[C@H]1CC(F)(F)F.[Cl-].[Cl-] |
| InChI | InChI=1S/C27H30F3N3O3.2ClH/c28-27(29,30)11-19-10-18(17-4-2-1-3-5-17)8-9-33(19)25(34)22-13-32-15-26(22)14-31-12-20-21(26)6-7-23-24(20)36-16-35-23;;/h1-7,18-19,22,31-32H,8-16H2;2*1H/p-2/t18-,19+,22+,26+;;/m1../s1 |
| InChIKey | BJSGMMPPIZGHCZ-ZFTPGCESSA-L |
| XLogP | -2.29 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |