C31H38ClN2O4- — CID 46892194
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(6S)-spiro[7,9-dihydro-[1,3]dioxolo[4,5-h]isochromene-6,4'-pyrrolidine]-3'-yl]methanone chloride (PubChem CID 46892194) has the molecular formula C31H38ClN2O4- and a molecular weight of 538.11 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(6S)-spiro[7,9-dihydro-[1,3]dioxolo[4,5-h]isochromene-6,4'-pyrrolidine]-3'-yl]methanone chloride.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(6S)-spiro[7,9-dihydro-[1,3]dioxolo[4,5-h]isochromene-6,4'-pyrrolidine]-3'-yl]methanone chloride |
|---|---|
| PubChem CID | 46892194 |
| Molecular Formula | C31H38ClN2O4- |
| Molecular Weight | 538.11 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(6S)-spiro[7,9-dihydro-[1,3]dioxolo[4,5-h]isochromene-6,4'-pyrrolidine]-3'-yl]methanone chloride |
| SMILES | O=C(C1CNC[C@]12COCc1c2ccc2c1OCO2)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C31H38N2O4.ClH/c34-30(26-16-32-18-31(26)19-35-17-24-25(31)11-12-28-29(24)37-20-36-28)33-14-13-23(21-7-3-1-4-8-21)15-27(33)22-9-5-2-6-10-22;/h1,3-4,7-8,11-12,22-23,26-27,32H,2,5-6,9-10,13-20H2;1H/p-1/t23-,26?,27+,31-;/m1./s1 |
| InChIKey | NATKTQSXPXCXBQ-QZZAYYGVSA-M |
| XLogP | 1.76 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |