C31H38ClF2N2O3- — CID 46893604
[(2S,4R)-2-(3,3-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone chloride (PubChem CID 46893604) has the molecular formula C31H38ClF2N2O3- and a molecular weight of 560.11 g/mol. Its IUPAC name is [(2S,4R)-2-(3,3-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone chloride.
| Compound Name | [(2S,4R)-2-(3,3-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone chloride |
|---|---|
| PubChem CID | 46893604 |
| Molecular Formula | C31H38ClF2N2O3- |
| Molecular Weight | 560.11 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | [(2S,4R)-2-(3,3-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone chloride |
| SMILES | COc1cccc2c1COC[C@]21CNC[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCC(F)(F)C1.[Cl-] |
| InChI | InChI=1S/C31H38F2N2O3.ClH/c1-37-28-11-5-10-25-24(28)18-38-20-30(25)19-34-17-26(30)29(36)35-14-12-22(21-7-3-2-4-8-21)15-27(35)23-9-6-13-31(32,33)16-23;/h2-5,7-8,10-11,22-23,26-27,34H,6,9,12-20H2,1H3;1H/p-1/t22-,23?,26+,27+,30-;/m1./s1 |
| InChIKey | FHAASKNNERPENG-QENWELFRSA-M |
| XLogP | 2.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |