C8H11N3 — CID 58549923
3-cyclopropyl-5-prop-2-enyl-1H-1,2,4-triazole (PubChem CID 58549923) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 3-cyclopropyl-5-prop-2-enyl-1H-1,2,4-triazole.
| Compound Name | 3-cyclopropyl-5-prop-2-enyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 58549923 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 3-cyclopropyl-5-prop-2-enyl-1H-1,2,4-triazole |
| SMILES | C=CCc1nc(C2CC2)n[nH]1 |
| InChI | InChI=1S/C8H11N3/c1-2-3-7-9-8(11-10-7)6-4-5-6/h2,6H,1,3-5H2,(H,9,10,11) |
| InChIKey | CNWFZZBAPDSZDQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|