C16H18N2O — CID 58551045
2-methylspiro[chromeno[4,3-c]pyrazole-4,1'-cyclohexane] (PubChem CID 58551045) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-methylspiro[chromeno[4,3-c]pyrazole-4,1'-cyclohexane].
| Compound Name | 2-methylspiro[chromeno[4,3-c]pyrazole-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 58551045 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-methylspiro[chromeno[4,3-c]pyrazole-4,1'-cyclohexane] |
| SMILES | Cn1cc2c(n1)-c1ccccc1OC21CCCCC1 |
| InChI | InChI=1S/C16H18N2O/c1-18-11-13-15(17-18)12-7-3-4-8-14(12)19-16(13)9-5-2-6-10-16/h3-4,7-8,11H,2,5-6,9-10H2,1H3 |
| InChIKey | WWOJJPQEWWUBAW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |