C20H25N5O5S — CID 58551937
3-[4-[4-(4-amino-2-methyl-6-oxo-5H-pyrrolo[2,3-d]pyrimidin-7-yl)butylsulfamoyl]phenyl]propanoic acid (PubChem CID 58551937) has the molecular formula C20H25N5O5S and a molecular weight of 447.52 g/mol. Its IUPAC name is 3-[4-[4-(4-amino-2-methyl-6-oxo-5H-pyrrolo[2,3-d]pyrimidin-7-yl)butylsulfamoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[4-(4-amino-2-methyl-6-oxo-5H-pyrrolo[2,3-d]pyrimidin-7-yl)butylsulfamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 58551937 |
| Molecular Formula | C20H25N5O5S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-[4-[4-(4-amino-2-methyl-6-oxo-5H-pyrrolo[2,3-d]pyrimidin-7-yl)butylsulfamoyl]phenyl]propanoic acid |
| SMILES | Cc1nc(N)c2c(n1)N(CCCCNS(=O)(=O)c1ccc(CCC(=O)O)cc1)C(=O)C2 |
| InChI | InChI=1S/C20H25N5O5S/c1-13-23-19(21)16-12-17(26)25(20(16)24-13)11-3-2-10-22-31(29,30)15-7-4-14(5-8-15)6-9-18(27)28/h4-5,7-8,22H,2-3,6,9-12H2,1H3,(H,27,28)(H2,21,23,24) |
| InChIKey | CMHPKUUGKVYLQS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|