C21H25NO2 — CID 58554687
9-amino-1-(4-phenylphenyl)nonane-1,4-dione (PubChem CID 58554687) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 9-amino-1-(4-phenylphenyl)nonane-1,4-dione.
| Compound Name | 9-amino-1-(4-phenylphenyl)nonane-1,4-dione |
|---|---|
| PubChem CID | 58554687 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 9-amino-1-(4-phenylphenyl)nonane-1,4-dione |
| SMILES | NCCCCCC(=O)CCC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO2/c22-16-6-2-5-9-20(23)14-15-21(24)19-12-10-18(11-13-19)17-7-3-1-4-8-17/h1,3-4,7-8,10-13H,2,5-6,9,14-16,22H2 |
| InChIKey | DZMYWHKKVVTKGS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|