About 9-amino-1-(4-phenylphenyl)nonane-1,4-dione
9-amino-1-(4-phenylphenyl)nonane-1,4-dione (PubChem CID 58554687) has the molecular formula C21H25NO2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 9-amino-1-(4-phenylphenyl)nonane-1,4-dione.
Molecular Properties
| Compound Name | 9-amino-1-(4-phenylphenyl)nonane-1,4-dione |
| PubChem CID | 58554687 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 9-amino-1-(4-phenylphenyl)nonane-1,4-dione |
| SMILES | NCCCCCC(=O)CCC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO2/c22-16-6-2-5-9-20(23)14-15-21(24)19-12-10-18(11-13-19)17-7-3-1-4-8-17/h1,3-4,7-8,10-13H,2,5-6,9,14-16,22H2 |
| InChIKey | DZMYWHKKVVTKGS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-1-(4-phenylphenyl)nonane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-1-(4-phenylphenyl)nonane-1,4-dione?
The IUPAC name of 9-amino-1-(4-phenylphenyl)nonane-1,4-dione (CID 58554687) is 9-amino-1-(4-phenylphenyl)nonane-1,4-dione.
What is the SMILES notation for 9-amino-1-(4-phenylphenyl)nonane-1,4-dione?
The canonical SMILES for 9-amino-1-(4-phenylphenyl)nonane-1,4-dione is NCCCCCC(=O)CCC(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 9-amino-1-(4-phenylphenyl)nonane-1,4-dione?
The InChIKey is DZMYWHKKVVTKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2/c22-16-6-2-5-9-20(23)14-15-21(24)19-12-10-18(11-13-19)17-7-3-1-4-8-17/h1,3-4,7-8,10-13H,2,5-6,9,14-16,22H2.
What are the key properties of 9-amino-1-(4-phenylphenyl)nonane-1,4-dione?
9-amino-1-(4-phenylphenyl)nonane-1,4-dione has a molecular weight of 323.44 g/mol, XLogP of 4.40, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-1-(4-phenylphenyl)nonane-1,4-dione is sourced from PubChem (CID 58554687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).