C17H16O4S — CID 58555118
(E)-3-(5-acetylthiophen-2-yl)-1-(2,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 58555118) has the molecular formula C17H16O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is (E)-3-(5-acetylthiophen-2-yl)-1-(2,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(5-acetylthiophen-2-yl)-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 58555118 |
| Molecular Formula | C17H16O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (E)-3-(5-acetylthiophen-2-yl)-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C(=O)/C=C/c2ccc(C(C)=O)s2)c1 |
| InChI | InChI=1S/C17H16O4S/c1-11(18)17-9-6-13(22-17)5-7-15(19)14-10-12(20-2)4-8-16(14)21-3/h4-10H,1-3H3/b7-5+ |
| InChIKey | CWUMSKPEWLRLOB-FNORWQNLSA-N |
| XLogP | 3.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|