C14H23F3O2 — CID 58555466
2-propyl-5-[4-(trifluoromethoxy)cyclohexyl]oxolane (PubChem CID 58555466) has the molecular formula C14H23F3O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-propyl-5-[4-(trifluoromethoxy)cyclohexyl]oxolane.
| Compound Name | 2-propyl-5-[4-(trifluoromethoxy)cyclohexyl]oxolane |
|---|---|
| PubChem CID | 58555466 |
| Molecular Formula | C14H23F3O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-propyl-5-[4-(trifluoromethoxy)cyclohexyl]oxolane |
| SMILES | CCCC1CCC(C2CCC(OC(F)(F)F)CC2)O1 |
| InChI | InChI=1S/C14H23F3O2/c1-2-3-11-8-9-13(18-11)10-4-6-12(7-5-10)19-14(15,16)17/h10-13H,2-9H2,1H3 |
| InChIKey | HZSVMASSMDXDSN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |