C27H34N4 — CID 58556241
5,6-bis(2,2-dimethylpropyl)-1,3-diphenyl-2H-imidazo[4,5-b]pyrazine (PubChem CID 58556241) has the molecular formula C27H34N4 and a molecular weight of 414.60 g/mol. Its IUPAC name is 5,6-bis(2,2-dimethylpropyl)-1,3-diphenyl-2H-imidazo[4,5-b]pyrazine.
| Compound Name | 5,6-bis(2,2-dimethylpropyl)-1,3-diphenyl-2H-imidazo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 58556241 |
| Molecular Formula | C27H34N4 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 5,6-bis(2,2-dimethylpropyl)-1,3-diphenyl-2H-imidazo[4,5-b]pyrazine |
| SMILES | CC(C)(C)Cc1nc2c(nc1CC(C)(C)C)N(c1ccccc1)CN2c1ccccc1 |
| InChI | InChI=1S/C27H34N4/c1-26(2,3)17-22-23(18-27(4,5)6)29-25-24(28-22)30(20-13-9-7-10-14-20)19-31(25)21-15-11-8-12-16-21/h7-16H,17-19H2,1-6H3 |
| InChIKey | PAKZHJKYFGUCON-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |