C24H22N6O3S — CID 58557922
1-[(1S)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]pyrrole-3-carbaldehyde (PubChem CID 58557922) has the molecular formula C24H22N6O3S and a molecular weight of 474.55 g/mol. Its IUPAC name is 1-[(1S)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]pyrrole-3-carbaldehyde.
| Compound Name | 1-[(1S)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 58557922 |
| Molecular Formula | C24H22N6O3S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-[(1S)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]pyrrole-3-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2nnc(C4CC[C@H](n5ccc(C=O)c5)C4)n23)cc1 |
| InChI | InChI=1S/C24H22N6O3S/c1-16-2-6-20(7-3-16)34(32,33)29-11-9-21-24(29)25-13-22-26-27-23(30(21)22)18-4-5-19(12-18)28-10-8-17(14-28)15-31/h2-3,6-11,13-15,18-19H,4-5,12H2,1H3/t18?,19-/m0/s1 |
| InChIKey | CEBOBBXYQUMXMK-GGYWPGCISA-N |
| XLogP | 3.75 |
| TPSA | 104.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|