C19H22F2N6O — CID 58558089
(4,4-difluoropiperidin-1-yl)-[(3R)-3-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone (PubChem CID 58558089) has the molecular formula C19H22F2N6O and a molecular weight of 388.42 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[(3R)-3-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[(3R)-3-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 58558089 |
| Molecular Formula | C19H22F2N6O |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[(3R)-3-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
| SMILES | O=C(N1CCC(F)(F)CC1)N1CCC[C@@H](c2cnc3cnc4[nH]ccc4n23)C1 |
| InChI | InChI=1S/C19H22F2N6O/c20-19(21)4-8-25(9-5-19)18(28)26-7-1-2-13(12-26)15-10-23-16-11-24-17-14(27(15)16)3-6-22-17/h3,6,10-11,13,22H,1-2,4-5,7-9,12H2/t13-/m1/s1 |
| InChIKey | KPKUECOZPCGPKJ-CYBMUJFWSA-N |
| XLogP | 3.24 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |