C25H20Cl2N4O2 — CID 58564253
2,6-dichloro-N-[4-[(6-oxo-7,8,9,10-tetrahydro-5H-benzo[c][1,8]naphthyridin-1-yl)amino]phenyl]benzamide (PubChem CID 58564253) has the molecular formula C25H20Cl2N4O2 and a molecular weight of 479.37 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-[(6-oxo-7,8,9,10-tetrahydro-5H-benzo[c][1,8]naphthyridin-1-yl)amino]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-[(6-oxo-7,8,9,10-tetrahydro-5H-benzo[c][1,8]naphthyridin-1-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 58564253 |
| Molecular Formula | C25H20Cl2N4O2 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2,6-dichloro-N-[4-[(6-oxo-7,8,9,10-tetrahydro-5H-benzo[c][1,8]naphthyridin-1-yl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Nc2ccnc3[nH]c(=O)c4c(c23)CCCC4)cc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H20Cl2N4O2/c26-18-6-3-7-19(27)22(18)25(33)30-15-10-8-14(9-11-15)29-20-12-13-28-23-21(20)16-4-1-2-5-17(16)24(32)31-23/h3,6-13H,1-2,4-5H2,(H,30,33)(H2,28,29,31,32) |
| InChIKey | SSCHBDIZHCXFNV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |