C25H25N5O2 — CID 58168114
1-methyl-N-[4-[(6-oxo-5H-benzo[c][1,8]naphthyridin-1-yl)amino]phenyl]piperidine-4-carboxamide (PubChem CID 58168114) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-methyl-N-[4-[(6-oxo-5H-benzo[c][1,8]naphthyridin-1-yl)amino]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-methyl-N-[4-[(6-oxo-5H-benzo[c][1,8]naphthyridin-1-yl)amino]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58168114 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-methyl-N-[4-[(6-oxo-5H-benzo[c][1,8]naphthyridin-1-yl)amino]phenyl]piperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)Nc2ccc(Nc3ccnc4[nH]c(=O)c5ccccc5c34)cc2)CC1 |
| InChI | InChI=1S/C25H25N5O2/c1-30-14-11-16(12-15-30)24(31)28-18-8-6-17(7-9-18)27-21-10-13-26-23-22(21)19-4-2-3-5-20(19)25(32)29-23/h2-10,13,16H,11-12,14-15H2,1H3,(H,28,31)(H2,26,27,29,32) |
| InChIKey | QEBFUABBIKEGJS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|