C31H22F2N4O2 — CID 58567485
4-[5-(2-benzylquinazolin-6-yl)pent-4-ynoyl]-2-[(3,4-difluorophenyl)methyl]pyridazin-3-one (PubChem CID 58567485) has the molecular formula C31H22F2N4O2 and a molecular weight of 520.54 g/mol. Its IUPAC name is 4-[5-(2-benzylquinazolin-6-yl)pent-4-ynoyl]-2-[(3,4-difluorophenyl)methyl]pyridazin-3-one.
| Compound Name | 4-[5-(2-benzylquinazolin-6-yl)pent-4-ynoyl]-2-[(3,4-difluorophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 58567485 |
| Molecular Formula | C31H22F2N4O2 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 4-[5-(2-benzylquinazolin-6-yl)pent-4-ynoyl]-2-[(3,4-difluorophenyl)methyl]pyridazin-3-one |
| SMILES | O=C(CCC#Cc1ccc2nc(Cc3ccccc3)ncc2c1)c1ccnn(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C31H22F2N4O2/c32-26-12-10-23(17-27(26)33)20-37-31(39)25(14-15-35-37)29(38)9-5-4-8-22-11-13-28-24(16-22)19-34-30(36-28)18-21-6-2-1-3-7-21/h1-3,6-7,10-17,19H,5,9,18,20H2 |
| InChIKey | UYWVZJJWNDALRL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|