C39H39F2N5O3 — CID 58567496
2-[(3,4-difluorophenyl)methyl]-4-[5-[2-[[4-[5-(dimethylamino)pentanoyl]phenyl]methyl]quinazolin-6-yl]pent-4-ynoyl]-1,5-dimethylpyrazol-3-one (PubChem CID 58567496) has the molecular formula C39H39F2N5O3 and a molecular weight of 663.77 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methyl]-4-[5-[2-[[4-[5-(dimethylamino)pentanoyl]phenyl]methyl]quinazolin-6-yl]pent-4-ynoyl]-1,5-dimethylpyrazol-3-one.
| Compound Name | 2-[(3,4-difluorophenyl)methyl]-4-[5-[2-[[4-[5-(dimethylamino)pentanoyl]phenyl]methyl]quinazolin-6-yl]pent-4-ynoyl]-1,5-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 58567496 |
| Molecular Formula | C39H39F2N5O3 |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methyl]-4-[5-[2-[[4-[5-(dimethylamino)pentanoyl]phenyl]methyl]quinazolin-6-yl]pent-4-ynoyl]-1,5-dimethylpyrazol-3-one |
| SMILES | Cc1c(C(=O)CCC#Cc2ccc3nc(Cc4ccc(C(=O)CCCCN(C)C)cc4)ncc3c2)c(=O)n(Cc2ccc(F)c(F)c2)n1C |
| InChI | InChI=1S/C39H39F2N5O3/c1-26-38(39(49)46(45(26)4)25-29-14-18-32(40)33(41)22-29)36(48)11-6-5-9-27-15-19-34-31(21-27)24-42-37(43-34)23-28-12-16-30(17-13-28)35(47)10-7-8-20-44(2)3/h12-19,21-22,24H,6-8,10-11,20,23,25H2,1-4H3 |
| InChIKey | XEJWYGLFFUWUBD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 90.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|