C18H15F3OS2 — CID 58568106
2-(2-thiophen-2-ylthiophen-3-yl)-1-[3-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 58568106) has the molecular formula C18H15F3OS2 and a molecular weight of 368.45 g/mol. Its IUPAC name is 2-(2-thiophen-2-ylthiophen-3-yl)-1-[3-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 2-(2-thiophen-2-ylthiophen-3-yl)-1-[3-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 58568106 |
| Molecular Formula | C18H15F3OS2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 2-(2-thiophen-2-ylthiophen-3-yl)-1-[3-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | CC(O)(Cc1cccc(C(F)(F)F)c1)c1ccsc1-c1cccs1 |
| InChI | InChI=1S/C18H15F3OS2/c1-17(22,11-12-4-2-5-13(10-12)18(19,20)21)14-7-9-24-16(14)15-6-3-8-23-15/h2-10,22H,11H2,1H3 |
| InChIKey | BAOJBIFXUFVYMK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |