About 5,5-difluorohexyl cyclohexanecarboxylate
5,5-difluorohexyl cyclohexanecarboxylate (PubChem CID 58568282) has the molecular formula C13H22F2O2
and a molecular weight of 248.31 g/mol. Its IUPAC name is 5,5-difluorohexyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | 5,5-difluorohexyl cyclohexanecarboxylate |
| PubChem CID | 58568282 |
| Molecular Formula | C13H22F2O2 |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 5,5-difluorohexyl cyclohexanecarboxylate |
| SMILES | CC(F)(F)CCCCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H22F2O2/c1-13(14,15)9-5-6-10-17-12(16)11-7-3-2-4-8-11/h11H,2-10H2,1H3 |
| InChIKey | RHEOMNFCDOKSRH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,5-difluorohexyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluorohexyl cyclohexanecarboxylate?
The IUPAC name of 5,5-difluorohexyl cyclohexanecarboxylate (CID 58568282) is 5,5-difluorohexyl cyclohexanecarboxylate.
What is the SMILES notation for 5,5-difluorohexyl cyclohexanecarboxylate?
The canonical SMILES for 5,5-difluorohexyl cyclohexanecarboxylate is CC(F)(F)CCCCOC(=O)C1CCCCC1.
What is the InChIKey of 5,5-difluorohexyl cyclohexanecarboxylate?
The InChIKey is RHEOMNFCDOKSRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F2O2/c1-13(14,15)9-5-6-10-17-12(16)11-7-3-2-4-8-11/h11H,2-10H2,1H3.
What are the key properties of 5,5-difluorohexyl cyclohexanecarboxylate?
5,5-difluorohexyl cyclohexanecarboxylate has a molecular weight of 248.31 g/mol, XLogP of 3.94, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluorohexyl cyclohexanecarboxylate is sourced from PubChem (CID 58568282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).