About CID 58568669
CID 58568669 (PubChem CID 58568669) has the molecular formula C56H34N4Pt
and a molecular weight of 957.99 g/mol.
Molecular Properties
| Compound Name | CID 58568669 |
| PubChem CID | 58568669 |
| Molecular Formula | C56H34N4Pt |
| Molecular Weight | 957.99 g/mol |
| Exact Mass | 957.24 |
| IUPAC Name | — |
| SMILES | [Pt+2].c1cc2nc(c1)C1([N-]c3ccc4ccccc4c3-c3cccc(n3)C3([N-]c4ccc5ccccc5c4-2)c2ccccc2-c2ccccc23)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C56H34N4.Pt/c1-3-17-37-35(15-1)31-33-49-53(37)47-27-13-29-51(57-47)56(45-25-11-7-21-41(45)42-22-8-12-26-46(42)56)60-50-34-32-36-16-2-4-18-38(36)54(50)48-28-14-30-52(58-48)55(59-49)43-23-9-5-19-39(43)40-20-6-10-24-44(40)55;/h1-34H;/q-2;+2 |
| InChIKey | PHACPOGLZNYWFP-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 957.99 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 58568669 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58568669?
The IUPAC name of CID 58568669 (CID 58568669) is not available.
What is the SMILES notation for CID 58568669?
The canonical SMILES for CID 58568669 is [Pt+2].c1cc2nc(c1)C1([N-]c3ccc4ccccc4c3-c3cccc(n3)C3([N-]c4ccc5ccccc5c4-2)c2ccccc2-c2ccccc23)c2ccccc2-c2ccccc21.
What is the InChIKey of CID 58568669?
The InChIKey is PHACPOGLZNYWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H34N4.Pt/c1-3-17-37-35(15-1)31-33-49-53(37)47-27-13-29-51(57-47)56(45-25-11-7-21-41(45)42-22-8-12-26-46(42)56)60-50-34-32-36-16-2-4-18-38(36)54(50)48-28-14-30-52(58-48)55(59-49)43-23-9-5-19-39(43)40-20-6-10-24-44(40)55;/h1-34H;/q-2;+2.
What are the key properties of CID 58568669?
CID 58568669 has a molecular weight of 957.99 g/mol, XLogP of 14.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58568669 is sourced from PubChem (CID 58568669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).