C21H18 — CID 59806731
spiro[benzo[c]fluorene-7,1'-cyclopentane] (PubChem CID 59806731) has the molecular formula C21H18 and a molecular weight of 270.38 g/mol. Its IUPAC name is spiro[benzo[c]fluorene-7,1'-cyclopentane].
| Compound Name | spiro[benzo[c]fluorene-7,1'-cyclopentane] |
|---|---|
| PubChem CID | 59806731 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | spiro[benzo[c]fluorene-7,1'-cyclopentane] |
| SMILES | c1ccc2c(c1)-c1c(ccc3ccccc13)C21CCCC1 |
| InChI | InChI=1S/C21H18/c1-2-8-16-15(7-1)11-12-19-20(16)17-9-3-4-10-18(17)21(19)13-5-6-14-21/h1-4,7-12H,5-6,13-14H2 |
| InChIKey | JMKBADTYUFBWED-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |