C25H41NO4 — CID 58572054
N-[(2R)-2-benzyl-8-hydroxy-1-methoxy-4-oxopentadecan-5-yl]acetamide (PubChem CID 58572054) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is N-[(2R)-2-benzyl-8-hydroxy-1-methoxy-4-oxopentadecan-5-yl]acetamide.
| Compound Name | N-[(2R)-2-benzyl-8-hydroxy-1-methoxy-4-oxopentadecan-5-yl]acetamide |
|---|---|
| PubChem CID | 58572054 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | N-[(2R)-2-benzyl-8-hydroxy-1-methoxy-4-oxopentadecan-5-yl]acetamide |
| SMILES | CCCCCCCC(O)CCC(NC(C)=O)C(=O)C[C@H](COC)Cc1ccccc1 |
| InChI | InChI=1S/C25H41NO4/c1-4-5-6-7-11-14-23(28)15-16-24(26-20(2)27)25(29)18-22(19-30-3)17-21-12-9-8-10-13-21/h8-10,12-13,22-24,28H,4-7,11,14-19H2,1-3H3,(H,26,27)/t22-,23?,24?/m1/s1 |
| InChIKey | OVPXTMAKVBZIFS-ZKMFCFPVSA-N |
| XLogP | 4.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|