C17H19F3O4 — CID 58572394
ethyl (E)-3-[2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]ethyl]-6-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 58572394) has the molecular formula C17H19F3O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is ethyl (E)-3-[2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]ethyl]-6-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]ethyl]-6-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58572394 |
| Molecular Formula | C17H19F3O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | ethyl (E)-3-[2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]ethyl]-6-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c([C@@H](C)OC[C@H]2CO2)cccc1C(F)(F)F |
| InChI | InChI=1S/C17H19F3O4/c1-3-22-16(21)8-7-14-13(11(2)23-9-12-10-24-12)5-4-6-15(14)17(18,19)20/h4-8,11-12H,3,9-10H2,1-2H3/b8-7+/t11-,12+/m1/s1 |
| InChIKey | XQVWTJABOWXTPU-LASXONHFSA-N |
| XLogP | 3.76 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|