C16H19FO4 — CID 123653115
ethyl 3-[2-fluoro-6-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]ethyl]phenyl]prop-2-enoate (PubChem CID 123653115) has the molecular formula C16H19FO4 and a molecular weight of 294.32 g/mol. Its IUPAC name is ethyl 3-[2-fluoro-6-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]ethyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[2-fluoro-6-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]ethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123653115 |
| Molecular Formula | C16H19FO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | ethyl 3-[2-fluoro-6-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]ethyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1c(F)cccc1[C@@H](C)OC[C@H]1CO1 |
| InChI | InChI=1S/C16H19FO4/c1-3-19-16(18)8-7-14-13(5-4-6-15(14)17)11(2)20-9-12-10-21-12/h4-8,11-12H,3,9-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | YCEMNQOWTIGBFZ-NEPJUHHUSA-N |
| XLogP | 2.88 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|