C18H23FO4 — CID 123854277
ethyl 3-[4-fluoro-5-methyl-2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]propyl]phenyl]prop-2-enoate (PubChem CID 123854277) has the molecular formula C18H23FO4 and a molecular weight of 322.38 g/mol. Its IUPAC name is ethyl 3-[4-fluoro-5-methyl-2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]propyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-fluoro-5-methyl-2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]propyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123854277 |
| Molecular Formula | C18H23FO4 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 3-[4-fluoro-5-methyl-2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]propyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(C)c(F)cc1[C@@H](CC)OC[C@H]1CO1 |
| InChI | InChI=1S/C18H23FO4/c1-4-17(23-11-14-10-22-14)15-9-16(19)12(3)8-13(15)6-7-18(20)21-5-2/h6-9,14,17H,4-5,10-11H2,1-3H3/t14-,17-/m1/s1 |
| InChIKey | QQRQBCAPHCJGNM-RHSMWYFYSA-N |
| XLogP | 3.58 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|