C17H23FO4 — CID 58580703
ethyl 3-[4-fluoro-2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]propyl]phenyl]propanoate (PubChem CID 58580703) has the molecular formula C17H23FO4 and a molecular weight of 310.37 g/mol. Its IUPAC name is ethyl 3-[4-fluoro-2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]propyl]phenyl]propanoate.
| Compound Name | ethyl 3-[4-fluoro-2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]propyl]phenyl]propanoate |
|---|---|
| PubChem CID | 58580703 |
| Molecular Formula | C17H23FO4 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | ethyl 3-[4-fluoro-2-[(1R)-1-[[(2R)-oxiran-2-yl]methoxy]propyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(F)cc1[C@@H](CC)OC[C@H]1CO1 |
| InChI | InChI=1S/C17H23FO4/c1-3-16(22-11-14-10-21-14)15-9-13(18)7-5-12(15)6-8-17(19)20-4-2/h5,7,9,14,16H,3-4,6,8,10-11H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | LPUHCBPKRJCKPS-GDBMZVCRSA-N |
| XLogP | 3.19 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|