C20H28O5 — CID 163997650
ethyl (E)-5-[4-ethoxy-2-[1-[[(2R)-oxiran-2-yl]methoxy]ethyl]phenyl]pent-4-enoate (PubChem CID 163997650) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is ethyl (E)-5-[4-ethoxy-2-[1-[[(2R)-oxiran-2-yl]methoxy]ethyl]phenyl]pent-4-enoate.
| Compound Name | ethyl (E)-5-[4-ethoxy-2-[1-[[(2R)-oxiran-2-yl]methoxy]ethyl]phenyl]pent-4-enoate |
|---|---|
| PubChem CID | 163997650 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | ethyl (E)-5-[4-ethoxy-2-[1-[[(2R)-oxiran-2-yl]methoxy]ethyl]phenyl]pent-4-enoate |
| SMILES | CCOC(=O)CC/C=C/c1ccc(OCC)cc1C(C)OC[C@H]1CO1 |
| InChI | InChI=1S/C20H28O5/c1-4-22-17-11-10-16(8-6-7-9-20(21)23-5-2)19(12-17)15(3)24-13-18-14-25-18/h6,8,10-12,15,18H,4-5,7,9,13-14H2,1-3H3/b8-6+/t15?,18-/m0/s1 |
| InChIKey | UGCYHVPLNBENKJ-VOZRNTNQSA-N |
| XLogP | 3.92 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|