C14H18O4 — CID 176649613
ethyl (E)-5-(2,3-dihydroxy-4-methylphenyl)pent-4-enoate (PubChem CID 176649613) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is ethyl (E)-5-(2,3-dihydroxy-4-methylphenyl)pent-4-enoate.
| Compound Name | ethyl (E)-5-(2,3-dihydroxy-4-methylphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 176649613 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl (E)-5-(2,3-dihydroxy-4-methylphenyl)pent-4-enoate |
| SMILES | CCOC(=O)CC/C=C/c1ccc(C)c(O)c1O |
| InChI | InChI=1S/C14H18O4/c1-3-18-12(15)7-5-4-6-11-9-8-10(2)13(16)14(11)17/h4,6,8-9,16-17H,3,5,7H2,1-2H3/b6-4+ |
| InChIKey | OKAZXTKZDQJTOB-GQCTYLIASA-N |
| XLogP | 2.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|