C27H34F2N4O4 — CID 58576875
3-[4-(3,4-difluorophenyl)piperidin-1-yl]-1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]propan-1-one (PubChem CID 58576875) has the molecular formula C27H34F2N4O4 and a molecular weight of 516.59 g/mol. Its IUPAC name is 3-[4-(3,4-difluorophenyl)piperidin-1-yl]-1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(3,4-difluorophenyl)piperidin-1-yl]-1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576875 |
| Molecular Formula | C27H34F2N4O4 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 3-[4-(3,4-difluorophenyl)piperidin-1-yl]-1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]propan-1-one |
| SMILES | CCOc1cc(NC2CCN(C(=O)CCN3CCC(c4ccc(F)c(F)c4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H34F2N4O4/c1-2-37-26-18-22(4-6-25(26)33(35)36)30-21-9-15-32(16-10-21)27(34)11-14-31-12-7-19(8-13-31)20-3-5-23(28)24(29)17-20/h3-6,17-19,21,30H,2,7-16H2,1H3 |
| InChIKey | UUDHROIJZPQZMM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|