About 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine
2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine (PubChem CID 58577274) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine.
Analyze 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine?
The IUPAC name of 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine (CID 58577274) is 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine?
The canonical SMILES for 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine is COC1N=C2C=CC=CN2C1C.
What is the InChIKey of 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine?
The InChIKey is CBBXEXREDHFCGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-7-9(12-2)10-8-5-3-4-6-11(7)8/h3-7,9H,1-2H3.
What are the key properties of 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine?
2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine has a molecular weight of 164.21 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-methyl-2,3-dihydroimidazo[1,2-a]pyridine is sourced from PubChem (CID 58577274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).