C8H10N2O — CID 93495665
(2R)-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol (PubChem CID 93495665) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is (2R)-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol.
| Compound Name | (2R)-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol |
|---|---|
| PubChem CID | 93495665 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (2R)-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol |
| SMILES | C[C@@]1(O)CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C8H10N2O/c1-8(11)6-10-5-3-2-4-7(10)9-8/h2-5,11H,6H2,1H3/t8-/m1/s1 |
| InChIKey | NZHUYUJZDAAHSZ-MRVPVSSYSA-N |
| XLogP | 0.49 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |