C9H8BrF5N2O — CID 141383832
2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol;hydrobromide (PubChem CID 141383832) has the molecular formula C9H8BrF5N2O and a molecular weight of 335.07 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol;hydrobromide.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol;hydrobromide |
|---|---|
| PubChem CID | 141383832 |
| Molecular Formula | C9H8BrF5N2O |
| Molecular Weight | 335.07 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol;hydrobromide |
| SMILES | Br.OC1(C(F)(F)C(F)(F)F)CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C9H7F5N2O.BrH/c10-8(11,9(12,13)14)7(17)5-16-4-2-1-3-6(16)15-7;/h1-4,17H,5H2;1H |
| InChIKey | UKTFUPLMPXAUJE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.07 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|