C9H8BrF3N2O — CID 141383829
3-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol (PubChem CID 141383829) has the molecular formula C9H8BrF3N2O and a molecular weight of 297.07 g/mol. Its IUPAC name is 3-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol.
| Compound Name | 3-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol |
|---|---|
| PubChem CID | 141383829 |
| Molecular Formula | C9H8BrF3N2O |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 3-bromo-5-methyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyridin-2-ol |
| SMILES | CC1=CC=CC2=NC(O)(C(F)(F)F)C(Br)N12 |
| InChI | InChI=1S/C9H8BrF3N2O/c1-5-3-2-4-6-14-8(16,9(11,12)13)7(10)15(5)6/h2-4,7,16H,1H3 |
| InChIKey | WPDFAQWCKXESKS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|