C10H9Br2F5N2O — CID 118035220
6-bromo-5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol;hydrobromide (PubChem CID 118035220) has the molecular formula C10H9Br2F5N2O and a molecular weight of 427.99 g/mol. Its IUPAC name is 6-bromo-5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol;hydrobromide.
| Compound Name | 6-bromo-5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol;hydrobromide |
|---|---|
| PubChem CID | 118035220 |
| Molecular Formula | C10H9Br2F5N2O |
| Molecular Weight | 427.99 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | 6-bromo-5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-imidazo[1,2-a]pyridin-2-ol;hydrobromide |
| SMILES | Br.CC1=C(Br)C=CC2=NC(O)(C(F)(F)C(F)(F)F)CN21 |
| InChI | InChI=1S/C10H8BrF5N2O.BrH/c1-5-6(11)2-3-7-17-8(19,4-18(5)7)9(12,13)10(14,15)16;/h2-3,19H,4H2,1H3;1H |
| InChIKey | UQWWLAIFTGFCHP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.99 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|