C24H26N4O — CID 58579688
6-(4-ethynylphenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 58579688) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 6-(4-ethynylphenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 6-(4-ethynylphenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 58579688 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 6-(4-ethynylphenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | C#Cc1ccc(-c2cnc3nc(N4CCC(N5CCCCC5)CC4)oc3c2)cc1 |
| InChI | InChI=1S/C24H26N4O/c1-2-18-6-8-19(9-7-18)20-16-22-23(25-17-20)26-24(29-22)28-14-10-21(11-15-28)27-12-4-3-5-13-27/h1,6-9,16-17,21H,3-5,10-15H2 |
| InChIKey | HFOKXMAHQZNBJQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|