C21H27N3O5 — CID 58582044
[(2S)-1-[[(1R)-1-cyano-2-phenylmethoxyethyl]amino]-4-methyl-1-oxopent-4-en-2-yl] morpholine-4-carboxylate (PubChem CID 58582044) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is [(2S)-1-[[(1R)-1-cyano-2-phenylmethoxyethyl]amino]-4-methyl-1-oxopent-4-en-2-yl] morpholine-4-carboxylate.
| Compound Name | [(2S)-1-[[(1R)-1-cyano-2-phenylmethoxyethyl]amino]-4-methyl-1-oxopent-4-en-2-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 58582044 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [(2S)-1-[[(1R)-1-cyano-2-phenylmethoxyethyl]amino]-4-methyl-1-oxopent-4-en-2-yl] morpholine-4-carboxylate |
| SMILES | C=C(C)C[C@H](OC(=O)N1CCOCC1)C(=O)N[C@H](C#N)COCc1ccccc1 |
| InChI | InChI=1S/C21H27N3O5/c1-16(2)12-19(29-21(26)24-8-10-27-11-9-24)20(25)23-18(13-22)15-28-14-17-6-4-3-5-7-17/h3-7,18-19H,1,8-12,14-15H2,2H3,(H,23,25)/t18-,19+/m1/s1 |
| InChIKey | MWTGOENBGUBJQV-MOPGFXCFSA-N |
| XLogP | 2.02 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|