C22H31N3O5 — CID 68830432
[1-[(1-cyano-1-phenylmethoxyethyl)amino]-4,4-dimethyl-1-oxopentan-2-yl] morpholine-4-carboxylate (PubChem CID 68830432) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is [1-[(1-cyano-1-phenylmethoxyethyl)amino]-4,4-dimethyl-1-oxopentan-2-yl] morpholine-4-carboxylate.
| Compound Name | [1-[(1-cyano-1-phenylmethoxyethyl)amino]-4,4-dimethyl-1-oxopentan-2-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 68830432 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [1-[(1-cyano-1-phenylmethoxyethyl)amino]-4,4-dimethyl-1-oxopentan-2-yl] morpholine-4-carboxylate |
| SMILES | CC(C)(C)CC(OC(=O)N1CCOCC1)C(=O)NC(C)(C#N)OCc1ccccc1 |
| InChI | InChI=1S/C22H31N3O5/c1-21(2,3)14-18(30-20(27)25-10-12-28-13-11-25)19(26)24-22(4,16-23)29-15-17-8-6-5-7-9-17/h5-9,18H,10-15H2,1-4H3,(H,24,26) |
| InChIKey | RJHVIUUXYUKMIT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|