C19H28N2O5 — CID 57046611
[(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl] morpholine-4-carboxylate (PubChem CID 57046611) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl] morpholine-4-carboxylate.
| Compound Name | [(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 57046611 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl] morpholine-4-carboxylate |
| SMILES | C[C@@H](CCCCNC(=O)OCc1ccccc1)OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H28N2O5/c1-16(26-19(23)21-11-13-24-14-12-21)7-5-6-10-20-18(22)25-15-17-8-3-2-4-9-17/h2-4,8-9,16H,5-7,10-15H2,1H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | HSTBRJORCAESKQ-INIZCTEOSA-N |
| XLogP | 2.94 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|