C20H25NO4S — CID 58583045
[(2S,5R)-2-phenyl-3-propan-2-yl-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58583045) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is [(2S,5R)-2-phenyl-3-propan-2-yl-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,5R)-2-phenyl-3-propan-2-yl-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58583045 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [(2S,5R)-2-phenyl-3-propan-2-yl-1,3-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2CN(C(C)C)[C@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-15(2)21-13-18(25-20(21)17-7-5-4-6-8-17)14-24-26(22,23)19-11-9-16(3)10-12-19/h4-12,15,18,20H,13-14H2,1-3H3/t18-,20+/m1/s1 |
| InChIKey | NHPHEXHPXOZAHM-QUCCMNQESA-N |
| XLogP | 3.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|