C27H31ClFN3O2 — CID 58583267
5-(2-chloro-4-methoxyphenyl)-3,6-diethyl-N-[(1R,2S)-2-(3-fluoropropoxy)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine (PubChem CID 58583267) has the molecular formula C27H31ClFN3O2 and a molecular weight of 484.02 g/mol. Its IUPAC name is 5-(2-chloro-4-methoxyphenyl)-3,6-diethyl-N-[(1R,2S)-2-(3-fluoropropoxy)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine.
| Compound Name | 5-(2-chloro-4-methoxyphenyl)-3,6-diethyl-N-[(1R,2S)-2-(3-fluoropropoxy)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 58583267 |
| Molecular Formula | C27H31ClFN3O2 |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 5-(2-chloro-4-methoxyphenyl)-3,6-diethyl-N-[(1R,2S)-2-(3-fluoropropoxy)-2,3-dihydro-1H-inden-1-yl]pyrazin-2-amine |
| SMILES | CCc1nc(-c2ccc(OC)cc2Cl)c(CC)nc1N[C@@H]1c2ccccc2C[C@@H]1OCCCF |
| InChI | InChI=1S/C27H31ClFN3O2/c1-4-22-25(20-12-11-18(33-3)16-21(20)28)30-23(5-2)27(31-22)32-26-19-10-7-6-9-17(19)15-24(26)34-14-8-13-29/h6-7,9-12,16,24,26H,4-5,8,13-15H2,1-3H3,(H,31,32)/t24-,26+/m0/s1 |
| InChIKey | CEFFNDSRJRXXIA-AZGAKELHSA-N |
| XLogP | 6.38 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|