C19H24ClF2N3O2 — CID 22249128
5-[2-chloro-4-(difluoromethoxy)phenyl]-3-ethyl-6-methoxy-N-pentan-3-ylpyrazin-2-amine (PubChem CID 22249128) has the molecular formula C19H24ClF2N3O2 and a molecular weight of 399.87 g/mol. Its IUPAC name is 5-[2-chloro-4-(difluoromethoxy)phenyl]-3-ethyl-6-methoxy-N-pentan-3-ylpyrazin-2-amine.
| Compound Name | 5-[2-chloro-4-(difluoromethoxy)phenyl]-3-ethyl-6-methoxy-N-pentan-3-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 22249128 |
| Molecular Formula | C19H24ClF2N3O2 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 5-[2-chloro-4-(difluoromethoxy)phenyl]-3-ethyl-6-methoxy-N-pentan-3-ylpyrazin-2-amine |
| SMILES | CCc1nc(-c2ccc(OC(F)F)cc2Cl)c(OC)nc1NC(CC)CC |
| InChI | InChI=1S/C19H24ClF2N3O2/c1-5-11(6-2)23-17-15(7-3)24-16(18(25-17)26-4)13-9-8-12(10-14(13)20)27-19(21)22/h8-11,19H,5-7H2,1-4H3,(H,23,25) |
| InChIKey | JEUYYAFVEZMKCM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |