C20H26F3N3O3 — CID 10295219
3-ethyl-6-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenyl]-N-pentan-3-ylpyrazin-2-amine (PubChem CID 10295219) has the molecular formula C20H26F3N3O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is 3-ethyl-6-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenyl]-N-pentan-3-ylpyrazin-2-amine.
| Compound Name | 3-ethyl-6-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenyl]-N-pentan-3-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 10295219 |
| Molecular Formula | C20H26F3N3O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 3-ethyl-6-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenyl]-N-pentan-3-ylpyrazin-2-amine |
| SMILES | CCc1nc(-c2ccc(OC(F)(F)F)cc2OC)c(OC)nc1NC(CC)CC |
| InChI | InChI=1S/C20H26F3N3O3/c1-6-12(7-2)24-18-15(8-3)25-17(19(26-18)28-5)14-10-9-13(11-16(14)27-4)29-20(21,22)23/h9-12H,6-8H2,1-5H3,(H,24,26) |
| InChIKey | YFIPDLXBDOAVAO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |