C21H32N2O6 — CID 58584220
phenyl (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 58584220) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is phenyl (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | phenyl (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 58584220 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | phenyl (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](NC(=O)OC(C)(C)C)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C21H32N2O6/c1-20(2,3)28-18(25)22-14-10-13-16(23-19(26)29-21(4,5)6)17(24)27-15-11-8-7-9-12-15/h7-9,11-12,16H,10,13-14H2,1-6H3,(H,22,25)(H,23,26)/t16-/m0/s1 |
| InChIKey | OHUBAFXXZDHBKW-INIZCTEOSA-N |
| XLogP | 3.79 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|