C16H24ClN — CID 58587113
5-(chloromethyl)-N,4a-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydronaphthalen-1-imine (PubChem CID 58587113) has the molecular formula C16H24ClN and a molecular weight of 265.83 g/mol. Its IUPAC name is 5-(chloromethyl)-N,4a-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydronaphthalen-1-imine.
| Compound Name | 5-(chloromethyl)-N,4a-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydronaphthalen-1-imine |
|---|---|
| PubChem CID | 58587113 |
| Molecular Formula | C16H24ClN |
| Molecular Weight | 265.83 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 5-(chloromethyl)-N,4a-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydronaphthalen-1-imine |
| SMILES | C=C(C)C1C/C(=N\C)C2=CCCC(CCl)C2(C)C1 |
| InChI | InChI=1S/C16H24ClN/c1-11(2)12-8-15(18-4)14-7-5-6-13(10-17)16(14,3)9-12/h7,12-13H,1,5-6,8-10H2,2-4H3/b18-15+ |
| InChIKey | YKMQIJBSYBZVFK-OBGWFSINSA-N |
| XLogP | 4.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.83 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|