C15H22ClNO — CID 58587107
(NZ)-N-[5-(chloromethyl)-4a-methyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydronaphthalen-1-ylidene]hydroxylamine (PubChem CID 58587107) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is (NZ)-N-[5-(chloromethyl)-4a-methyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydronaphthalen-1-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[5-(chloromethyl)-4a-methyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydronaphthalen-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 58587107 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (NZ)-N-[5-(chloromethyl)-4a-methyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydronaphthalen-1-ylidene]hydroxylamine |
| SMILES | C=C(C)C1C/C(=N/O)C2=CCCC(CCl)C2(C)C1 |
| InChI | InChI=1S/C15H22ClNO/c1-10(2)11-7-14(17-18)13-6-4-5-12(9-16)15(13,3)8-11/h6,11-12,18H,1,4-5,7-9H2,2-3H3/b17-14- |
| InChIKey | TVXBZOJASMFXOO-VKAVYKQESA-N |
| XLogP | 4.38 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|