C12H19NO — CID 92526502
(NZ)-N-[(4aR)-1,1-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]hydroxylamine (PubChem CID 92526502) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (NZ)-N-[(4aR)-1,1-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4aR)-1,1-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 92526502 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (NZ)-N-[(4aR)-1,1-dimethyl-3,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]hydroxylamine |
| SMILES | CC1(C)C2=CCCC[C@@H]2CC/C1=N/O |
| InChI | InChI=1S/C12H19NO/c1-12(2)10-6-4-3-5-9(10)7-8-11(12)13-14/h6,9,14H,3-5,7-8H2,1-2H3/b13-11-/t9-/m1/s1 |
| InChIKey | RDIKGIOQSIHVHA-JLDYROKLSA-N |
| XLogP | 3.36 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|